Introduction：Basic information about CAS 24731-73-5|N,N'-(1,4-Phenylene)bis(acetoacetamide), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N'-(1,4-Phenylene)bis(acetoacetamide) |
|---|
| CAS Number | 24731-73-5 | Molecular Weight | 276.28800 |
|---|
| Density | 1.279 g/cm3 | Boiling Point | 582.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.4ºC |
|---|
Names
| Name | 3-oxo-N-[4-(3-oxobutanoylamino)phenyl]butanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.279 g/cm3 |
|---|
| Boiling Point | 582.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O4 |
|---|
| Molecular Weight | 276.28800 |
|---|
| Flash Point | 234.4ºC |
|---|
| Exact Mass | 276.11100 |
|---|
| PSA | 92.34000 |
|---|
| LogP | 1.66780 |
|---|
| Vapour Pressure | 1.52E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | OWGNKUKYZPVEFS-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)Nc1ccc(NC(=O)CC(C)=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N.N'-Bis-acetoacetyl-p-phenylendiamin |
| 1,4-bis-(acetoacetylamino)-benzene |
| N,N'-p-Phenylen-bis-acetoacetamid |
| EINECS 246-438-8 |
| N,N'-1,4-phenylenebis(3-oxobutyramide) |
| N,N'-p-phenylene-bis-acetoacetamide |
| 1,4-bis(3-oxobutanamido)benzene |
| MFCD00026257 |
| 1,4-Bis-acetoacetylamino-benzol |
| N,N'-(1,4-PHENYLENE)BIS(ACETOACETAMIDE) |
| n,n'-1,4-phenylenebis(3-oxobutanamide) |
| N,N'-(1,4-Phenylene)bis(3-oxobutanamide) |
