Introduction：Basic information about CAS 2741-57-3|1-(Dichloromethyl)-2-(trichloromethyl)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(Dichloromethyl)-2-(trichloromethyl)benzene |
|---|
| CAS Number | 2741-57-3 | Molecular Weight | 278.390 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 310.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5Cl5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.1±23.9 °C |
|---|
Names
| Name | 1-(dichloromethyl)-2-(trichloromethyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 310.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H5Cl5 |
|---|
| Molecular Weight | 278.390 |
|---|
| Flash Point | 142.1±23.9 °C |
|---|
| Exact Mass | 275.883392 |
|---|
| LogP | 3.71 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | UXMNSLMVCBBGCW-UHFFFAOYSA-N |
|---|
| SMILES | ClC(Cl)c1ccccc1C(Cl)(Cl)Cl |
|---|
Safety Information
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Benzene, 1-(dichloromethyl)-2-(trichloromethyl)- |
| Benzene,1-(dichloromethyl)-2-(trichloromethyl) |
| α,α,α,α',α'-pentachloro-O-xylene |
| 1-Dichlormethyl-2-trichlormethyl-benzol |
| o-dichloromethyltrichloromethylbenzene |
| MFCD00128834 |
| Benzene, 1- (dichloromethyl)-2-(trichloromethyl)- |
| o-Xylene, α,α,α,α',α'-pentachloro- |
| EINECS 220-371-4 |
| 1-(Dichloromethyl)-2-(trichloromethyl)benzene |
| 1-dichloromethyl-2-trichloromethyl-benzene |
