Introduction：Basic information about CAS 287917-57-1|3-(chloromethyl)-5-(3,4-dichlorophenyl)-1,2,4-oxadiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(chloromethyl)-5-(3,4-dichlorophenyl)-1,2,4-oxadiazole |
|---|
| CAS Number | 287917-57-1 | Molecular Weight | 263.50800 |
|---|
| Density | 1.5g/cm3 | Boiling Point | 382.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H5Cl3N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.2ºC |
|---|
Names
| Name | 3-(chloromethyl)-5-(3,4-dichlorophenyl)-1,2,4-oxadiazole |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Boiling Point | 382.6ºC at 760mmHg |
|---|
| Molecular Formula | C9H5Cl3N2O |
|---|
| Molecular Weight | 263.50800 |
|---|
| Flash Point | 185.2ºC |
|---|
| Exact Mass | 261.94700 |
|---|
| PSA | 38.92000 |
|---|
| LogP | 3.78220 |
|---|
| Vapour Pressure | 1.03E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | GJYOCYRIQUMWSG-UHFFFAOYSA-N |
|---|
| SMILES | ClCc1noc(-c2ccc(Cl)c(Cl)c2)n1 |
|---|
