Introduction：Basic information about CAS 29899-95-4|Clobenoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Clobenoside |
|---|
| CAS Number | 29899-95-4 | Molecular Weight | 499.42400 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 602ºC at 760mmHg |
|---|
| Molecular Formula | C25H32Cl2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.9ºC |
|---|
Names
| Name | Clobenoside |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 602ºC at 760mmHg |
|---|
| Molecular Formula | C25H32Cl2O6 |
|---|
| Molecular Weight | 499.42400 |
|---|
| Flash Point | 317.9ºC |
|---|
| Exact Mass | 498.15800 |
|---|
| PSA | 66.38000 |
|---|
| LogP | 5.01290 |
|---|
| Vapour Pressure | 2.42E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | UOYOWSGCMGEQHC-MSEXXDKFSA-N |
|---|
| SMILES | CCCOC1C(O)C(OCC)OC1C(COCc1ccc(Cl)cc1)OCc1ccc(Cl)cc1 |
|---|
Synonyms
| Ethyl 5-O,6-O-bis(4-chlorobenzyl)-3-O-propyl-D-glucofuranoside |
| Ethyl 5-O,6-O-bis[(4-chlorophenyl)methyl]-3-O-propyl-D-glucofuranoside |
| (3R,4R,5R)-5-[(1R)-1,2-Bis[(4-chlorophenyl)methoxy]ethyl]-2-ethoxy-4-propoxyoxolan-3-ol |
| Ethyl 5,6-bis-O-(p-chlorobenzyl)-3-O-propyl-D-glucofuranoside |
