Introduction:Basic information about CAS 107294-87-1|3-amino-n-[2-(2-hydroxyethyl)sulfonyl]ethyl benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-n-[2-(2-hydroxyethyl)sulfonyl]ethyl benzamide |
|---|
| CAS Number | 107294-87-1 | Molecular Weight | 272.32100 |
|---|
| Density | 1.361g/cm3 | Boiling Point | 625.501ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 332.091ºC |
|---|
Names
| Name | 3-amino-n-[2-(2-hydroxyethyl)sulfonyl]ethyl benzamide |
|---|
Chemical & Physical Properties
| Density | 1.361g/cm3 |
|---|
| Boiling Point | 625.501ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16N2O4S |
|---|
| Molecular Weight | 272.32100 |
|---|
| Flash Point | 332.091ºC |
|---|
| Exact Mass | 272.08300 |
|---|
| PSA | 117.87000 |
|---|
| LogP | 1.45860 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | CNJXPCYNPBIQRD-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(C(=O)NCCS(=O)(=O)CCO)c1 |
|---|