Introduction：Basic information about CAS 2904-41-8|Tris(2-carboxyethyl) isocyanurate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tris(2-carboxyethyl) isocyanurate |
|---|
| CAS Number | 2904-41-8 | Molecular Weight | 345.26200 |
|---|
| Density | 1.604g/cm3 | Boiling Point | 694.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H15N3O9 | Melting Point | 222ºC |
|---|
| MSDS | / | Flash Point | 373.6ºC |
|---|
Names
| Name | 3-[3,5-bis(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.604g/cm3 |
|---|
| Boiling Point | 694.1ºC at 760mmHg |
|---|
| Melting Point | 222ºC |
|---|
| Molecular Formula | C12H15N3O9 |
|---|
| Molecular Weight | 345.26200 |
|---|
| Flash Point | 373.6ºC |
|---|
| Exact Mass | 345.08100 |
|---|
| PSA | 177.90000 |
|---|
| Vapour Pressure | 4.27E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | HENCHDCLZDQGIQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCn1c(=O)n(CCC(=O)O)c(=O)n(CCC(=O)O)c1=O |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2933699090 |
|---|
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 3,3',3''-(2,4,6-trioxo-[1,3,5]triazinane-1,3,5-triyl)-tris-propionic acid |
| tris(2-carboxyethyl)isocyanirate |
| Isocyanuric Acid Tris(2-carboxyethyl) Ester |
| tri(2-carboxyethyl)isocyanurate |
| tris(2-carboxyethyl)isocyanuric acid |
| TRIS(2-CARBOXYETHYL) ISOCYANURATE |
| 1,3,5-Triazine-1,3,5(2H,4H,6H)-tripropanoic acid,2,4,6-trioxo |
| EINECS 220-803-1 |
