Introduction:Basic information about CAS 376-68-1|2,2,3,3,4,4-Hexafluoropentanedioic Anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2,3,3,4,4-Hexafluoropentanedioic Anhydride |
|---|
| CAS Number | 376-68-1 | Molecular Weight | 222.04200 |
|---|
| Density | 1.654 g/mL at 25 °C(lit.) | Boiling Point | 72 °C(lit.) |
|---|
| Molecular Formula | C5F6O3 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | None |
|---|
| Symbol | GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | hexafluoroglutaric anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.654 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 72 °C(lit.) |
|---|
| Molecular Formula | C5F6O3 |
|---|
| Molecular Weight | 222.04200 |
|---|
| Flash Point | None |
|---|
| Exact Mass | 221.97500 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 0.97570 |
|---|
| Index of Refraction | n20/D 1.324(lit.) |
|---|
| InChIKey | IHYAGCYJVNHXCT-UHFFFAOYSA-N |
|---|
| SMILES | O=C1OC(=O)C(F)(F)C(F)(F)C1(F)F |
|---|
Safety Information
| Symbol | GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314-H335 |
|---|
| Precautionary Statements | P260-P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi: Irritant;C: Corrosive; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | 3265 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | TM0860000 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,2,3,3,4,4-Hexafluoropentanedioic Anhydride |
| MFCD00006680 |
| Hexafluoroglutaric Anhydride |
| 3,3,4,4,5,5-hexafluorooxane-2,6-dione |
| EINECS 206-811-8 |