Introduction:Basic information about CAS 936074-51-0|1-(5-Chloro-2-benzoxazolyl)-4-piperidinecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(5-Chloro-2-benzoxazolyl)-4-piperidinecarboxylic acid |
|---|
| CAS Number | 936074-51-0 | Molecular Weight | 280.70700 |
|---|
| Density | 1.431 | Boiling Point | 472.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.431 |
|---|
| Boiling Point | 472.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13ClN2O3 |
|---|
| Molecular Weight | 280.70700 |
|---|
| Exact Mass | 280.06100 |
|---|
| PSA | 66.57000 |
|---|
| LogP | 2.84720 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | ZWXCRCVLSBGYFC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CCN(c2nc3cc(Cl)ccc3o2)CC1 |
|---|