Introduction:Basic information about CAS 23632-70-4|ZL-Asp(tBu)-OH * DCHA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZL-Asp(tBu)-OH * DCHA |
|---|
| CAS Number | 23632-70-4 | Molecular Weight | 504.659 |
|---|
| Density | / | Boiling Point | 666.9ºC at 760mmHg |
|---|
| Molecular Formula | C28H44N2O6 | Melting Point | 107-109ºC |
|---|
| MSDS | / | Flash Point | 357.1ºC |
|---|
Names
| Name | N-Benzyloxycarbonyl-L-aspartic Acid β-tert-Butyl Ester Dicyclohexylamine Salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 666.9ºC at 760mmHg |
|---|
| Melting Point | 107-109ºC |
|---|
| Molecular Formula | C28H44N2O6 |
|---|
| Molecular Weight | 504.659 |
|---|
| Flash Point | 357.1ºC |
|---|
| Exact Mass | 504.319946 |
|---|
| PSA | 113.96000 |
|---|
| LogP | 6.12100 |
|---|
| Vapour Pressure | 1.07E-18mmHg at 25°C |
|---|
| InChIKey | JEGXFHMMFLKBBW-YDALLXLXSA-N |
|---|
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)CC(NC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-tert-butoxy-4-oxobutanoic acid - N-cyclohexylcyclohexanamine (1:1) (non-preferred name) |
| L-Aspartic acid, N-[(phenylmethoxy)carbonyl]-, 4-(1,1-dimethylethyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1) |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid - N-cyclohexylcyclohexanamine (1:1) |
| Z-Asp-OtBu DCHA |
| N-cyclohexylcyclohexanamine,(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| Z-Asp-OtBu.DCHA |
| Z-Asp-OtBu·DCHA |
| Z-Asp(OBut)-OH·DCHA |