Introduction：Basic information about CAS 41687-30-3|2-(3-Nitrophenylsulfonyl)ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-Nitrophenylsulfonyl)ethanol |
|---|
| CAS Number | 41687-30-3 | Molecular Weight | 231.22600 |
|---|
| Density | 1.472g/cm3 | Boiling Point | 475.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO5S | Melting Point | 76-78ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 241.3ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(3-nitrophenyl)sulfonylethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.472g/cm3 |
|---|
| Boiling Point | 475.4ºC at 760mmHg |
|---|
| Melting Point | 76-78ºC(lit.) |
|---|
| Molecular Formula | C8H9NO5S |
|---|
| Molecular Weight | 231.22600 |
|---|
| Flash Point | 241.3ºC |
|---|
| Exact Mass | 231.02000 |
|---|
| PSA | 108.57000 |
|---|
| LogP | 1.96480 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | VMORQDKKMBAQPJ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)CCO)c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2906299090 |
|---|
Customs
| HS Code | 2906299090 |
|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2-(3-Nitro-benzolsulfonyl)-aethanol |
| 2-(3-Nitrophenylsulfonyl)ethanol |
| 2-(3-nitrobenzenesulfonyl)ethanol |
| AC1L55T2 |
| EINECS 255-501-9 |
| CTK4I5118 |
| 3-[(2-hydroxyethyl)sulfonyl]-nitrobenzene |
| ACMC-20aoq5 |
| MFCD00134178 |
