Introduction：Basic information about CAS 4830-57-3|Sodium 2,3,4,5,6-pentafluorobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sodium 2,3,4,5,6-pentafluorobenzoate |
|---|
| CAS Number | 4830-57-3 | Molecular Weight | 234.05500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7F5NaO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | sodium,2,3,4,5,6-pentafluorobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7F5NaO2 |
|---|
| Molecular Weight | 234.05500 |
|---|
| Exact Mass | 233.97200 |
|---|
| PSA | 40.13000 |
|---|
| LogP | 0.74560 |
|---|
| InChIKey | TYLVUOJLQDVPMQ-UHFFFAOYSA-M |
|---|
| SMILES | O=C([O-])c1c(F)c(F)c(F)c(F)c1F.[Na+] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Na-perfluorbenzoat |
| Sodium 2,3,4,5,6-pentafluorobenzoate |
| Natriumpentafluorbenzoat |
| PC4558 |
| Pentafluornatriumbenzoat |
| sodium pentafluorobenzoate |
| pentafluoro sodium benzoate |
| sodium 2,3,4,5,6-pentakis(fluoranyl)benzoate |
