Introduction：Basic information about CAS 101-57-5|Benzenesulfonic acid,4-(phenylamino)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,4-(phenylamino)- |
|---|
| CAS Number | 101-57-5 | Molecular Weight | 249.28600 |
|---|
| Density | 1.398 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H11NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-anilinobenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.398 g/cm3 |
|---|
| Molecular Formula | C12H11NO3S |
|---|
| Molecular Weight | 249.28600 |
|---|
| Exact Mass | 249.04600 |
|---|
| PSA | 74.78000 |
|---|
| LogP | 3.83070 |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | HYKDWGUFDOYDGV-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc(Nc2ccccc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-(phenylamino)benzenesulphonic acid |
| diphenylamine sulfonic acid |
| Diphenylaminosulfonic acid |
| EINECS 202-955-0 |
| Benzenesulfonic acid,4-(phenylamino) |
| N-phenyl-sulfanilic acid |
| Benzenesulfonic acid,p-anilino |
| Diphenylamine-4-sulfonic acid |
| N-Phenyl-sulfanilsaeure |
| p-Anilinobenzenesulfonic acid |
| 4-Sulfodiphenylamine |
| N-Phenyl-p-aminobenzenesulfonic acid |
| diphenylamine-4-sulphonic acid |
| 4-Anilino-benzol-sulfonsaeure-(1) |
