Introduction：Basic information about CAS 2987-68-0|Vat Red 42, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vat Red 42 |
|---|
| CAS Number | 2987-68-0 | Molecular Weight | 446.45400 |
|---|
| Density | 1.409g/cm3 | Boiling Point | 549.5ºC at 760 mmHg |
|---|
| Molecular Formula | C28H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.3ºC |
|---|
Names
| Name | N-(4-benzamido-9,10-dioxoanthracen-1-yl)benzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.409g/cm3 |
|---|
| Boiling Point | 549.5ºC at 760 mmHg |
|---|
| Molecular Formula | C28H18N2O4 |
|---|
| Molecular Weight | 446.45400 |
|---|
| Flash Point | 156.3ºC |
|---|
| Exact Mass | 446.12700 |
|---|
| PSA | 92.34000 |
|---|
| LogP | 5.11260 |
|---|
| Vapour Pressure | 4.01E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.74 |
|---|
| InChIKey | SMYVNUCSIRQQNT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(NC(=O)c2ccccc2)c2c1C(=O)c1ccccc1C2=O)c1ccccc1 |
|---|
Synonyms
| N,N'-(9,10-dihydro-9,10-dioxoanthracene-1,4-diyl)bisbenzamide |
| 1,4-Bis-benzoylamino-anthrachinon |
| Indanthren Red 5GK |
| Indanthrenrot 5 GK |
| Romantrene Red F5GK |
| Benzadone Red 5G |
| 1.4-Bis-benzamino-anthrachinon |
| 1,4-bisbenzoylaminoanthraquinone |
| C.I. Vat Red 42 |
| 1,4-bisbenzoylamido-9,10-anthracenedione |
| n,n'-(9,10-dioxo-9,10-dihydroanthracene-1,4-diyl)dibenzamide |
