Introduction：Basic information about CAS 5098-14-6|aminomalononitrile p-toluenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | aminomalononitrile p-toluenesulfonate |
|---|
| CAS Number | 5098-14-6 | Molecular Weight | 253.27800 |
|---|
| Density | / | Boiling Point | 484ºC at 760mmHg |
|---|
| Molecular Formula | C10H11N3O3S | Melting Point | 174 °C (dec.)(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 246.5ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-aminopropanedinitrile,4-methylbenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 484ºC at 760mmHg |
|---|
| Melting Point | 174 °C (dec.)(lit.) |
|---|
| Molecular Formula | C10H11N3O3S |
|---|
| Molecular Weight | 253.27800 |
|---|
| Flash Point | 246.5ºC |
|---|
| Exact Mass | 253.05200 |
|---|
| PSA | 136.35000 |
|---|
| LogP | 2.38366 |
|---|
| InChIKey | MEUWQVWJLLBVQI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N#CC(N)C#N |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 + H312 + H332 |
|---|
| Precautionary Statements | P280 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S36 |
|---|
| RIDADR | 3439 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Articles1
More Articles
| Efficient synthesis of 2,9-disubstituted 8-hydroxyadenine derivatives. Org. Biomol. Chem. 1(8) , 1354-65, (2003) An efficient and general method for the synthesis of 2,9-disubstituted 8-hydroxyadenines, which are expected to have various biological activities, was realized. 5-Amino-4-cyano-2-hydroxyimidazoles(1)... | |
Synonyms
| aminomalononitrile tosylate |
| dicyanomethanaminium 4-methylbenzenesulfonate |
| Aminomalononitrile p-toluenesulfonate |
| EINECS 225-817-1 |
| Dicyanomethylammonium p-Toluenesulfonate |
| aminomalonitrile tosylate |
| Aminomalononitrile p-Toluenesulfonic Acid |
| 2-Aminomalononitrile 4-methylbenzenesulfonate |
| Aminomalononitrile p-toluenesulphonate |
| 2-aminomalononitrile p-toluenesulfonate |
| aminomalononitrile 4-toluenesulfonate |
| 2-Aminomalononitrile 4-methylbenzenesulphonate |
| MFCD00012848 |
| (dicyanomethyl)ammonium p-toluenesulfonate |
