Introduction:Basic information about CAS 72846-00-5|1-Benzyl-5-phenylbarbituric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Benzyl-5-phenylbarbituric acid |
|---|
| CAS Number | 72846-00-5 | Molecular Weight | 294.305 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H14N2O3 | Melting Point | 163-165°C |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | 1-Benzyl-5-phenylbarbituric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Melting Point | 163-165°C |
|---|
| Molecular Formula | C17H14N2O3 |
|---|
| Molecular Weight | 294.305 |
|---|
| Exact Mass | 294.100433 |
|---|
| PSA | 66.48000 |
|---|
| LogP | 2.55 |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | KCWWCWMGJOWTMY-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NC(=O)N(Cc2ccccc2)C(=O)C1c1ccccc1 |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | 25 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2933540000 |
|---|
Customs
| HS Code | 2933540000 |
|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
Synonyms
| 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-phenyl-1-(phenylmethyl)- |
| EINECS 276-940-2 |
| MFCD00082750 |
| 1-benzyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| 1-Benzyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 1-Benzyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |