Introduction：Basic information about CAS 88875-60-9|2-(3,4-dichlorophenyl)-2-phenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3,4-dichlorophenyl)-2-phenylacetic acid |
|---|
| CAS Number | 88875-60-9 | Molecular Weight | 281.13400 |
|---|
| Density | 1.373g/cm3 | Boiling Point | 403.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.8ºC |
|---|
Names
| Name | 2-(3,4-dichlorophenyl)-2-phenylacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.373g/cm3 |
|---|
| Boiling Point | 403.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H10Cl2O2 |
|---|
| Molecular Weight | 281.13400 |
|---|
| Flash Point | 197.8ºC |
|---|
| Exact Mass | 280.00600 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.20990 |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | XHOSLHVZDULGLF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| PPD-Q04-0 |
| AR3869 |
| 3,4-dichlorodiphenylacetic acid |
| Benzeneacetic acid,3,4-dichloro-a-phenyl |
| 2-(1H-PYRAZOL-3-YL)-PIPERAZINE |
