Introduction：Basic information about CAS 108478-21-3|(4'-Methoxy-2-biphenylyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4'-Methoxy-2-biphenylyl)acetic acid |
|---|
| CAS Number | 108478-21-3 | Molecular Weight | 242.270 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 434.5±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.4±20.3 °C |
|---|
Names
| Name | 2-[2-(4-methoxyphenyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 434.5±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H14O3 |
|---|
| Molecular Weight | 242.270 |
|---|
| Flash Point | 165.4±20.3 °C |
|---|
| Exact Mass | 242.094299 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.08 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | QYTGRAKPKIWJGN-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2ccccc2CC(=O)O)cc1 |
|---|
Synonyms
| [1,1'-Biphenyl]-2-acetic acid, 4'-methoxy- |
| 4'-Methoxy-biphenyl-2-acetic acid |
| 2-Biphenyl-(4'-methoxy)aceticacid |
| (4'-Methoxy-biphenyl-2-yl)-essigsaeure |
| [1,1'-Biphenyl]-2-aceticacid,4'-methoxy |
| (4'-Methoxy-2-biphenylyl)acetic acid |
| (4'-Methoxybiphenyl-2-yl)acetic acid |
| (4'-methoxy-biphenyl-2-yl)-acetic acid |
