Introduction:Basic information about CAS 32122-11-5|methyl 4-benzyloxybenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 4-benzyloxybenzoate |
|---|
| CAS Number | 32122-11-5 | Molecular Weight | 242.27000 |
|---|
| Density | 1.142g/cm3 | Boiling Point | 372.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O3 | Melting Point | 99°C |
|---|
| MSDS | / | Flash Point | 156.2ºC |
|---|
Names
| Name | methyl 4-phenylmethoxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.142g/cm3 |
|---|
| Boiling Point | 372.5ºC at 760mmHg |
|---|
| Melting Point | 99°C |
|---|
| Molecular Formula | C15H14O3 |
|---|
| Molecular Weight | 242.27000 |
|---|
| Flash Point | 156.2ºC |
|---|
| Exact Mass | 242.09400 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.05220 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | ZLLQTDQOTFCCDF-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(OCc2ccccc2)cc1 |
|---|
Safety Information
Synonyms
| Methyl 4-benzyloxybenzoate |
| Methyl 4-(benzyloxy)benzoate |
| methyl 4-hydroxybenzoate benzyl ether |
| p-Benzyloxybenzoic Acid Methyl Ester |
| 4-benzyloxy-benzoic acid methyl ester |
| MFCD00017613 |
| 4-Benzyloxybenzoic Acid Methyl Ester |
| methyl p-benzyloxybenzoate |