Introduction:Basic information about CAS 104333-83-7|Dimethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate |
|---|
| CAS Number | 104333-83-7 | Molecular Weight | 280.27300 |
|---|
| Density | 1.225g/cm3 | Boiling Point | 359.2ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16O6 | Melting Point | 54-58°C |
|---|
| MSDS | / | Flash Point | 156.8ºC |
|---|
Names
| Name | (2r,3r)-2,3-o-(1-phenylethylidene)-l-tartaric acid dimethyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.225g/cm3 |
|---|
| Boiling Point | 359.2ºC at 760 mmHg |
|---|
| Melting Point | 54-58°C |
|---|
| Molecular Formula | C14H16O6 |
|---|
| Molecular Weight | 280.27300 |
|---|
| Flash Point | 156.8ºC |
|---|
| Exact Mass | 280.09500 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 0.98930 |
|---|
| Vapour Pressure | 2.42E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | XFSCUQFGXSPZCK-GHMZBOCLSA-N |
|---|
| SMILES | COC(=O)C1OC(C)(c2ccccc2)OC1C(=O)OC |
|---|
Synonyms
| DiMethyl (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartrate |
| Dimethyl (4R,5R)-2-Methyl-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| Phenylethylidenetartaricaciddimethylester |
| (2R,3R)-2,3-O-(1-Phenylethylidene)-L-tartaric Acid Dimethyl Ester |