Introduction：Basic information about CAS 2995-45-1|3-(Trifluoromethoxy)nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(Trifluoromethoxy)nitrobenzene |
|---|
| CAS Number | 2995-45-1 | Molecular Weight | 207.107 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 209.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4F3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 80.5±25.9 °C |
|---|
Names
| Name | 3-(Trifluoromethoxy)nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 209.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4F3NO3 |
|---|
| Molecular Weight | 207.107 |
|---|
| Flash Point | 80.5±25.9 °C |
|---|
| Exact Mass | 207.014328 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.20 |
|---|
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.476 |
|---|
| InChIKey | QBWJNDOQIAARBT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(OC(F)(F)F)c1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 3-Nitrophenyl trifluoromethyl ether |
| MFCD00041011 |
| Benzene, 1-nitro-3-(trifluoromethoxy)- |
| 1-Nitro-3-(trifluoromethoxy)benzene |
| 3-Nitro-1-trifluormethoxy-benzol |
| 3-trifluoromethoxy nitrobenzene |
| 3-(Trifluoromethoxy)nitrobenzene |
| Trifluormethyl-3-nitrophenyl-ether |
| 3-Trifluormethoxy-1-nitro-benzol |
