Introduction：Basic information about CAS 10397-58-7|4-methoxy-3-nitrobenzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methoxy-3-nitrobenzamide |
|---|
| CAS Number | 10397-58-7 | Molecular Weight | 196.16000 |
|---|
| Density | 1.362g/cm3 | Boiling Point | 332.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O4 | Melting Point | 173-176°C |
|---|
| MSDS | / | Flash Point | 154.8ºC |
|---|
Names
| Name | 4-methoxy-3-nitrobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.362g/cm3 |
|---|
| Boiling Point | 332.3ºC at 760 mmHg |
|---|
| Melting Point | 173-176°C |
|---|
| Molecular Formula | C8H8N2O4 |
|---|
| Molecular Weight | 196.16000 |
|---|
| Flash Point | 154.8ºC |
|---|
| Exact Mass | 196.04800 |
|---|
| PSA | 98.14000 |
|---|
| LogP | 1.92580 |
|---|
| Vapour Pressure | 0.000147mmHg at 25°C |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | PCQFJXUTKOUTRW-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(N)=O)cc1[N+](=O)[O-] |
|---|
| Storage condition | -20°C |
|---|
Safety Information
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S22-S26-S36/37/39 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Methoxy-3-nitrobenzamid |
| p-Anisamide,3-nitro |
| 3-Nitro-4-methoxy-benzamid |
| 3-Nitro-p-anisamide |
| 4-Methoxy-3-Nitro-Benzamide |
| 4-Methoxy-3-nitro-benzoesaeure-amid |
| 4-methoxy-3-nitro-benzoic acid amide |
| EINECS 233-859-7 |
| MFCD00017136 |
