Introduction:Basic information about CAS 17573-93-2|2,3,4,5,6-PENTACHLORO-1-PYRIDINIUMOLATE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5,6-PENTACHLORO-1-PYRIDINIUMOLATE |
|---|
| CAS Number | 17573-93-2 | Molecular Weight | 267.32500 |
|---|
| Density | 1.92g/cm3 | Boiling Point | 434.1ºC at 760mmHg |
|---|
| Molecular Formula | C5Cl5NO | Melting Point | 179ºC |
|---|
| MSDS | / | Flash Point | 216.3ºC |
|---|
Names
| Name | 2,3,4,5,6-pentachloro-1-oxidopyridin-1-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.92g/cm3 |
|---|
| Boiling Point | 434.1ºC at 760mmHg |
|---|
| Melting Point | 179ºC |
|---|
| Molecular Formula | C5Cl5NO |
|---|
| Molecular Weight | 267.32500 |
|---|
| Flash Point | 216.3ºC |
|---|
| Exact Mass | 264.84200 |
|---|
| PSA | 25.46000 |
|---|
| LogP | 4.38210 |
|---|
| Vapour Pressure | 2.48E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | BBMHWFCIWRBYFW-UHFFFAOYSA-N |
|---|
| SMILES | [O-][n+]1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| pentachloropyridine N-oxide |
| 2.3.4.5.6-Pentachlorpyridin-1-oxid |
| Pentachlor-pyridin-1-oxid |
| Pentachloropyridine oxide |
| pentachloropyridine 1-oxide |
| Pyridine,pentachloro-,1-oxide |
| pentachloropyridin-1-ium-1-olate |
| 2,3,4,5,6-pentachloro-1-pyridiniumolate |
| Pentachloropyridin-N-oxid |
| Pentachlorpyridin-N-oxid |