Introduction：Basic information about CAS 95056-36-3|N-7-(2-(Nitrophenyldithio)ethyl)mitomycin C, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-7-(2-(Nitrophenyldithio)ethyl)mitomycin C |
|---|
| CAS Number | 95056-36-3 | Molecular Weight | 547.60400 |
|---|
| Density | 1.57g/cm3 | Boiling Point | 777.9ºC at 760mmHg |
|---|
| Molecular Formula | C23H25N5O7S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 424.3ºC |
|---|
Names
| Name | Bmy-25067 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.57g/cm3 |
|---|
| Boiling Point | 777.9ºC at 760mmHg |
|---|
| Molecular Formula | C23H25N5O7S2 |
|---|
| Molecular Weight | 547.60400 |
|---|
| Flash Point | 424.3ºC |
|---|
| Exact Mass | 547.12000 |
|---|
| PSA | 229.32000 |
|---|
| LogP | 3.20950 |
|---|
| Index of Refraction | 1.718 |
|---|
| InChIKey | ZNDJOCJUBZZAMN-USYHLRJESA-N |
|---|
| SMILES | COC12C(COC(N)=O)C3=C(C(=O)C(C)=C(NCCSSc4ccc([N+](=O)[O-])cc4)C3=O)N1CC1NC12 |
|---|
Synonyms
| Azirino(2',3':3,4)pyrrolo(1,2-a)indole-4,7-dione,8-(((aminocarbonyl)oxy)methyl)-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methyl-6-((2-((4-nitrophenyl)dithio)ethyl)amino)-,(1aS-(1aalpha,8beta,8aalpha,8balpha)) |
| N-7-(2-(Nitrophenyldithio)ethyl)mitomycin C |
