Introduction：Basic information about CAS 122665-73-0|cmda, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cmda |
|---|
| CAS Number | 122665-73-0 | Molecular Weight | 450.89100 |
|---|
| Density | 1.446g/cm3 | Boiling Point | 761.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H23ClN2O8S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 414.2ºC |
|---|
Names
| Name | (2S)-2-[[4-[2-chloroethyl(2-methylsulfonyloxyethyl)amino]benzoyl]amino]pentanedioic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.446g/cm3 |
|---|
| Boiling Point | 761.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H23ClN2O8S |
|---|
| Molecular Weight | 450.89100 |
|---|
| Flash Point | 414.2ºC |
|---|
| Exact Mass | 450.08600 |
|---|
| PSA | 158.69000 |
|---|
| LogP | 2.22750 |
|---|
| Vapour Pressure | 2.3E-24mmHg at 25°C |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | QVWYCTGTGHDWFQ-AWEZNQCLSA-N |
|---|
| SMILES | CS(=O)(=O)OCCN(CCCl)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| CMDA |
| 4-((2-Chloroethyl)(2-mesyloxyethyl)amino)benzoylglutamic acid |
| L-Glutamic acid,N-[4-[(2-chloroethyl)[2-[(methylsulfonyl)oxy]ethyl]amino]benzoyl] |
| 4-Cema-benzoyl-glutamic acid |
| QC-1210 |
| N-{4-[(2-chloroethyl)(2-mesyloxyethyl)amino]benzoyl}-L-glutamic acid |
| 4-[(2-chloroethyl)[2-(mesyloxy)ethyl]amino]benzoyl-L-glutamic acid |
