Introduction：Basic information about CAS 23046-03-9|5,6-Dimethoxy-1-benzothiophene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-Dimethoxy-1-benzothiophene-2-carboxylic acid |
|---|
| CAS Number | 23046-03-9 | Molecular Weight | 238.260 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 424.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.7±27.3 °C |
|---|
Names
| Name | 5,6-Dimethoxy-1-benzothiophene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 424.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10O4S |
|---|
| Molecular Weight | 238.260 |
|---|
| Flash Point | 210.7±27.3 °C |
|---|
| Exact Mass | 238.029984 |
|---|
| PSA | 84.00000 |
|---|
| LogP | 3.72 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | LIZUZUKHOVUSNS-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc2cc(C(=O)O)sc2cc1OC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5,6-dimethoxybenzo[b]thiophene-2-carboxylic acid |
| 5,6-Dimethoxy-1-benzothiophene-2-carboxylic acid |
| 5,6-Dimethoxy-benzo[b]thiophen-2-carbonsaeure |
| dimethoxybenzothiophenecarboxylicacid |
| 5,6-Dimethoxybenzothiophen-2-carboxyamide |
| Benzo[b]thiophene-2-carboxylic acid, 5,6-dimethoxy- |
| 5,6-Dimethoxybenzothiophene-2-carboxylic acid |
| 5,6-Dimethoxy-benzothiophen-carbonsaeure-(2) |
