Introduction：Basic information about CAS 2488-18-8|Boc-met-onp, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-met-onp |
|---|
| CAS Number | 2488-18-8 | Molecular Weight | 370.42100 |
|---|
| Density | 1.244 g/cm3 | Boiling Point | 536.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H22N2O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 278ºC |
|---|
Names
| Name | (4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.244 g/cm3 |
|---|
| Boiling Point | 536.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H22N2O6S |
|---|
| Molecular Weight | 370.42100 |
|---|
| Flash Point | 278ºC |
|---|
| Exact Mass | 370.12000 |
|---|
| PSA | 135.75000 |
|---|
| LogP | 4.06070 |
|---|
| InChIKey | KSFQSYDCSRCMIR-ZDUSSCGKSA-N |
|---|
| SMILES | CSCCC(NC(=O)OC(C)(C)C)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| boc-L-methionine p-nitrophenyl ester |
| Boc-L-Met-ONp |
| p-nitrophenyl ester of tert-butyloxycarbonyl-L-methionine |
| Boc-Met-ONp |
| tert-butyloxycarbonyl-L-methionine p-nitrophenyl ester |
