Introduction：Basic information about CAS 375-19-9|heptafluorobutyrylamidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | heptafluorobutyrylamidine |
|---|
| CAS Number | 375-19-9 | Molecular Weight | 212.06900 |
|---|
| Density | 1.67 g/cm3 | Boiling Point | 61ºCat 760 mmHg |
|---|
| Molecular Formula | C4H3F7N2 | Melting Point | 49 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2,3,3,4,4,4-heptafluorobutanimidamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.67 g/cm3 |
|---|
| Boiling Point | 61ºCat 760 mmHg |
|---|
| Melting Point | 49 °C |
|---|
| Molecular Formula | C4H3F7N2 |
|---|
| Molecular Weight | 212.06900 |
|---|
| Exact Mass | 212.01800 |
|---|
| PSA | 49.87000 |
|---|
| LogP | 2.55530 |
|---|
| Index of Refraction | 1.324 |
|---|
| InChIKey | HYMJOTOLJAHZCH-UHFFFAOYSA-N |
|---|
| SMILES | N=C(N)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2925290090 |
|---|
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Heptafluorbutyramidin |
| 2,2,3,3,4,4,4-heptafluoro-butyramidine |
| Heptafluorobutyrylamidine |
| 2,2,3,3,4,4,4-Heptafluor-butyramidin |
| Perfluor-butyramidin |
| MFCD00236736 |
| Perfluorbutyryl-amidin |
| heptafluorobutanimidamide |
| heptafluorobutyramidine |
