Introduction:Basic information about CAS 375-34-8|hexafluoro-2,2,3,3-tetrachlorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | hexafluoro-2,2,3,3-tetrachlorobutane |
|---|
| CAS Number | 375-34-8 | Molecular Weight | 303.84500 |
|---|
| Density | 1.76 | Boiling Point | 131 °C |
|---|
| Molecular Formula | C4Cl4F6 | Melting Point | 83 °C |
|---|
| MSDS | / | Flash Point | 45.1ºC |
|---|
Names
| Name | 2,2,3,3-tetrachloro-1,1,1,4,4,4-hexafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.76 |
|---|
| Boiling Point | 131 °C |
|---|
| Melting Point | 83 °C |
|---|
| Molecular Formula | C4Cl4F6 |
|---|
| Molecular Weight | 303.84500 |
|---|
| Flash Point | 45.1ºC |
|---|
| Exact Mass | 301.86600 |
|---|
| LogP | 4.45880 |
|---|
| Index of Refraction | 1.388 |
|---|
| InChIKey | BZBLUUDREZEDDJ-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(Cl)(Cl)C(Cl)(Cl)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 206-787-9 |
| MFCD00042088 |
| 1,1,1,4,4,4-hexa-fluoro-2,2,3,3-tetrachlorobutane |
| Butane,2,2,3,3-tetrachloro-1,1,1,4,4,4-hexafluoro |
| Butane S2-46 |
| 2,2,3,3-tetrachloro-1,1,1,4,4,4-hexafluoro-butane |
| FC 316maa |
| Butane,2,2,3,3-tetrachlorohexafluoro |
| CFC 316 |
| 2,2,3,3-Tetrachlor-hexafluor-butan |
| 2,2,3,3-tetrachloro-hexafluoro-butane |