Introduction:Basic information about CAS 880105-72-6|AKOS BB-7578, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | AKOS BB-7578 |
|---|
| CAS Number | 880105-72-6 | Molecular Weight | 216.66600 |
|---|
| Density | 1.269g/cm3 | Boiling Point | 380.971ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClN2 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 184.205ºC |
|---|
| Symbol | GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 2-Chloro-8-ethylquinoline-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.269g/cm3 |
|---|
| Boiling Point | 380.971ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClN2 |
|---|
| Molecular Weight | 216.66600 |
|---|
| Flash Point | 184.205ºC |
|---|
| Exact Mass | 216.04500 |
|---|
| PSA | 36.68000 |
|---|
| LogP | 3.32228 |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | XLZCPZRZKGVZIP-UHFFFAOYSA-N |
|---|
| SMILES | CCc1cccc2cc(C#N)c(Cl)nc12 |
|---|
Safety Information
| Symbol | GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 3-Quinolinecarbonitrile,2-chloro-8-ethyl |
| 2-CHLORO-8-ETHYL-3-QUINOLINECARBONITRILE |
| 2-chloro-3-cyano-8-ethylquinoline |
| 8-ethyl-2-chloro-3-cyanoquinoline |