Introduction:Basic information about CAS 4833-91-4|2-Pyridinecarboxylicacid, 5-sulfo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pyridinecarboxylicacid, 5-sulfo- |
|---|
| CAS Number | 4833-91-4 | Molecular Weight | 203.17300 |
|---|
| Density | 1.722g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H5NO5S | Melting Point | 287ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-sulfopyridine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.722g/cm3 |
|---|
| Melting Point | 287ºC |
|---|
| Molecular Formula | C6H5NO5S |
|---|
| Molecular Weight | 203.17300 |
|---|
| Exact Mass | 202.98900 |
|---|
| PSA | 112.94000 |
|---|
| LogP | 1.10730 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | CAIORIXOHHAHET-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cn1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Sulfo-pyridin-2-carbonsaeure |
| 5-sulfo-pyridine-2-carboxylic acid |
| 5-Sulfopicolinic acid |
| 2-Carboxy-pyridin-5-sulfonsaeure |
| 2-Pyridinecarboxylicacid,5-sulfo |
| 5-sulfo-2-pyridinecarboxylic acid |