Introduction:Basic information about CAS 2132-62-9|1-methoxy-4-[2-(4-methoxyphenyl)ethynyl]benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-methoxy-4-[2-(4-methoxyphenyl)ethynyl]benzene |
|---|
| CAS Number | 2132-62-9 | Molecular Weight | 238.28100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 653.4ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O2 | Melting Point | 143ºC |
|---|
| MSDS | / | Flash Point | 348.9ºC |
|---|
Names
| Name | 1-methoxy-4-[2-(4-methoxyphenyl)ethynyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 653.4ºC at 760 mmHg |
|---|
| Melting Point | 143ºC |
|---|
| Molecular Formula | C16H14O2 |
|---|
| Molecular Weight | 238.28100 |
|---|
| Flash Point | 348.9ºC |
|---|
| Exact Mass | 238.09900 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.10360 |
|---|
| Vapour Pressure | 7.71E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | YKUOFMNGWLZXHA-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C#Cc2ccc(OC)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1,2-bis(4-dimethoxybenzene)acetylene |
| 1-methoxy-4-(4'-methoxyphenylethynyl)-benzene |
| 1,2-prbis-(p-methoxyphenyl)acetylene |
| AmbscL34/TU-019 |
| Acetylene,bis(p-methoxyphenyl) |
| di(4-methoxyphenyl)acetylene |
| Bis(4-methoxyphenyl)acetylene |
| 1,2-Bis(4-methoxyphenyl)ethyne |