Introduction:Basic information about CAS 52184-19-7|6-[(2-Nitrophenyl)azo]-2,4-di-tert-pentylphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-[(2-Nitrophenyl)azo]-2,4-di-tert-pentylphenol |
|---|
| CAS Number | 52184-19-7 | Molecular Weight | 383.48400 |
|---|
| Density | 1.105g/cm3 | Boiling Point | 497.453ºC at 760 mmHg |
|---|
| Molecular Formula | C22H29N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.651ºC |
|---|
Names
| Name | (6E)-2,4-bis(2-methylbutan-2-yl)-6-[(2-nitrophenyl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.105g/cm3 |
|---|
| Boiling Point | 497.453ºC at 760 mmHg |
|---|
| Molecular Formula | C22H29N3O3 |
|---|
| Molecular Weight | 383.48400 |
|---|
| Flash Point | 254.651ºC |
|---|
| Exact Mass | 383.22100 |
|---|
| PSA | 90.77000 |
|---|
| LogP | 7.61420 |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | HHUOYYNHGMRSIF-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1cc(N=Nc2ccccc2[N+](=O)[O-])c(O)c(C(C)(C)CC)c1 |
|---|
Synonyms
| 6-((2-Nitrophenyl)azo)-2,4-di-tert-pentylphenol |
| Phenol,2,4-bis(1,1-dimethylpropyl)-6-((2-nitrophenyl)azo) |
| 2,4-Bis(tert-pentyl)-6-[(2-nitrophenyl)azo]phenol |
| 2,4-bis(1,1-dimethylpropyl)-6-[(E)-(2-nitrophenyl)diazenyl]phenol |
| EINECS 257-716-3 |
| Phenol,2,4-bis(1,1-dimethylpropyl)-6-(2-(2-nitrophenyl)diazenyl) |