Introduction：Basic information about CAS 23552-74-1|3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthrylene)diimino]bis[N-cyclohexyl-2,4,6-trim, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,3'-[(9,10-dihydro-9,10-dioxo-1,4-anthrylene)diimino]bis[N-cyclohexyl-2,4,6-trimethylbenzenesulphonamide] |
|---|
| CAS Number | 23552-74-1 | Molecular Weight | 797.03700 |
|---|
| Density | 1.34 | Boiling Point | 900.2ºC at 760mmHg |
|---|
| Molecular Formula | C44H52N4O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 498.2ºC |
|---|
Names
| Name | N-cyclohexyl-3-[[4-[3-(cyclohexylsulfamoyl)-2,4,6-trimethylanilino]-9,10-dioxoanthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonamide |
|---|
Chemical & Physical Properties
| Density | 1.34 |
|---|
| Boiling Point | 900.2ºC at 760mmHg |
|---|
| Molecular Formula | C44H52N4O6S2 |
|---|
| Molecular Weight | 797.03700 |
|---|
| Flash Point | 498.2ºC |
|---|
| Exact Mass | 796.33300 |
|---|
| PSA | 167.30000 |
|---|
| LogP | 12.11100 |
|---|
| Vapour Pressure | 3.75E-33mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | AYYCRXDSCYPSRP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(S(=O)(=O)NC2CCCCC2)c(C)c1Nc1ccc(Nc2c(C)cc(C)c(S(=O)(=O)NC3CCCCC3)c2C)c2c1C(=O)c1ccccc1C2=O |
|---|
