Introduction：Basic information about CAS 2650-44-4|1-naphthyl phosphate monosodium salt monohydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-naphthyl phosphate monosodium salt monohydrate |
|---|
| CAS Number | 2650-44-4 | Molecular Weight | 264.14700 |
|---|
| Density | / | Boiling Point | 451ºC at 760mmHg |
|---|
| Molecular Formula | C10H10NaO5P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.6ºC |
|---|
Names
| Name | 1-naphthyl phosphate monosodium salt monohydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 451ºC at 760mmHg |
|---|
| Molecular Formula | C10H10NaO5P |
|---|
| Molecular Weight | 264.14700 |
|---|
| Flash Point | 226.6ºC |
|---|
| Exact Mass | 264.01600 |
|---|
| PSA | 88.63000 |
|---|
| LogP | 2.68520 |
|---|
| Appearance of Characters | powder | white to off-white |
|---|
| InChIKey | DELRLFMUZXCKAR-UHFFFAOYSA-M |
|---|
| SMILES | O=P([O-])(O)Oc1cccc2ccccc12.[Na+] |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | H2O: 50 mg/mL |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 1-naphthylphosphate,monosodium salt |
| 1-[(2-chloro-phenyl)-naphthalen-1-yl-methyl]-1H-imidazole |
| Phosphorigsaeure-(naphthyl-(1)-ester)-dichlorid |
| (Naphthyl-(1))-dichlorophosphit |
| phosphorodichloridous acid naphthalen-1-yl ester |
| 1-naphthyloxydichlorophosphine |
| dichloro-[1]naphthyloxy-phosphine |
| Dichlorophosphorigsaeure-(naphthyl-(1)-ester) |
| 1-Naphthyl-o-chlorphenyl-methylimidazol-1 |
