CAS 523-39-7|Menlaquinone 9
Introduction：Basic information about CAS 523-39-7|Menlaquinone 9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Menlaquinone 9 | ||
|---|---|---|---|
| CAS Number | 523-39-7 | Molecular Weight | 771.207 |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 799.0±60.0 °C at 760 mmHg |
| Molecular Formula | C55H78O2 | Melting Point | 60-61ºC |
| MSDS | / | Flash Point | 278.0±29.9 °C |
Names
| Name | 2-methyl-3-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl]naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 799.0±60.0 °C at 760 mmHg |
| Melting Point | 60-61ºC |
| Molecular Formula | C55H78O2 |
| Molecular Weight | 771.207 |
| Flash Point | 278.0±29.9 °C |
| Exact Mass | 770.600159 |
| PSA | 34.14000 |
| LogP | 20.71 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | WCRXHNIUHQUASO-UVZVDVBNSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1=C(C)C(=O)c2ccccc2C1=O |
| Storage condition | 2-8℃ |
Synonyms
| Vitamin K2(45) |
| 2-methyl-3-nonaisoprenyl-1,4-naphthoquinone |
| all-trans-Vitamin K2(45) |
| Menachinon-9 |
| all-trans-Menachinon-9 |
| Menaquinone-9 |
| 1,4-Naphthalenedione, 2-methyl-3-[(2E,6E,10E,14E,18E,21E,25E,29E)-3,7,11,15,19,22,26,30,34-nonamethyl-2,6,10,14,18,21,25,29,33-pentatriacontanonaen-1-yl]- |
| 2-methyl-3-((2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl)naphthalene-1,4-dione |
| 2-Methyl-3-[(2E,6E,10E,14E,18E,21E,25E,29E)-3,7,11,15,19,22,26,30,34-nonamethyl-2,6,10,14,18,21,25,29,33-pentatriacontanonaen-1-yl]-1,4-naphthoquinone |
| MK9 |
| Menaquinone MK 9 |
| Vitamin MK 9 |
| Menlaquinone 9 |
