Introduction：Basic information about CAS 934570-41-9|(2,3,4,5,6-pentafluorophenyl) 6-phenylpyridine-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,3,4,5,6-pentafluorophenyl) 6-phenylpyridine-3-carboxylate |
|---|
| CAS Number | 934570-41-9 | Molecular Weight | 365.25400 |
|---|
| Density | 1.447g/cm3 | Boiling Point | 500.6ºC at 760mmHg |
|---|
| Molecular Formula | C18H8F5NO2 | Melting Point | 113ºC |
|---|
| MSDS | / | Flash Point | 256.6ºC |
|---|
Names
| Name | (2,3,4,5,6-pentafluorophenyl) 6-phenylpyridine-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.447g/cm3 |
|---|
| Boiling Point | 500.6ºC at 760mmHg |
|---|
| Melting Point | 113ºC |
|---|
| Molecular Formula | C18H8F5NO2 |
|---|
| Molecular Weight | 365.25400 |
|---|
| Flash Point | 256.6ºC |
|---|
| Exact Mass | 365.04800 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 4.66330 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | YUPUNKGUYBKZST-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(-c2ccccc2)nc1 |
|---|
Synonyms
| Y4746 |
| pentafluorophenyl 6-phenylpyridine-3-carboxylate |
| Pentafluorophenyl 2-phenylpyridine-5-carboxylate |
| Pentafluorophenyl 6-phenylnicotinate |
