Introduction:Basic information about CAS 946409-25-2|2-thiophen-2-ylpyrimidine-5-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-thiophen-2-ylpyrimidine-5-carbonyl chloride |
|---|
| CAS Number | 946409-25-2 | Molecular Weight | 224.66700 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 262.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5ClN2OS | Melting Point | >150ºC |
|---|
| MSDS | / | Flash Point | 112.3ºC |
|---|
Names
| Name | 2-thiophen-2-ylpyrimidine-5-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 262.1ºC at 760 mmHg |
|---|
| Melting Point | >150ºC |
|---|
| Molecular Formula | C9H5ClN2OS |
|---|
| Molecular Weight | 224.66700 |
|---|
| Flash Point | 112.3ºC |
|---|
| Exact Mass | 223.98100 |
|---|
| PSA | 71.09000 |
|---|
| LogP | 2.58410 |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | LUAIVFGXNDEYFW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cnc(-c2cccs2)nc1 |
|---|
Synonyms
| 2-Thien-2-ylpyrimidine-5-carbonyl chloride |