Introduction:Basic information about CAS 941-55-9|tosylazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tosylazide |
|---|
| CAS Number | 941-55-9 | Molecular Weight | 197.214 |
|---|
| Density | ~0.90 g/mL at 20 °C | Boiling Point | / |
|---|
| Molecular Formula | C7H7N3O2S | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | 4℃ |
|---|
| Symbol | GHS02, GHS06, GHS08 | Signal Word | Danger |
|---|
Names
| Name | P-Toluenesulfonyl Azide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | ~0.90 g/mL at 20 °C |
|---|
| Molecular Formula | C7H7N3O2S |
|---|
| Molecular Weight | 197.214 |
|---|
| Flash Point | 4℃ |
|---|
| Exact Mass | 197.025894 |
|---|
| PSA | 92.27000 |
|---|
| LogP | 2.52756 |
|---|
| Index of Refraction | n20/D 1.548 |
|---|
| InChIKey | NDLIRBZKZSDGSO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N=[N+]=[N-])cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS02, GHS06, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H225-H300-H304-H315-H336-H361d-H373 |
|---|
| Precautionary Statements | P210-P261-P264-P281-P301 + P310-P331 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | F |
|---|
| Risk Phrases | R5 |
|---|
| Safety Phrases | 16-35 |
|---|
| RIDADR | UN REST |
|---|
| HS Code | 2929909090 |
|---|
Customs
| HS Code | 2929909090 |
|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| p-Toluenesulfonyl azide (8CI) |
| tosylazide |
| diazonio-(4-methylphenyl)sulfonylazanide |
| p-Tolylsulfonyl azide |
| p-Methylphenylsulfonyl azide |
| Tosyl azide |
| 4-Methylbenzenesulfonyl azide |
| Benzenesulfonyl azide, 4-methyl- |
| p-Toluenesulfonyl azide |
| p-Toluenesulfonyl azide or 4-Methylbenzenesulfonyl azide |
| p-Toluenesulfonic acid azide |