Introduction：Basic information about CAS 5107-18-6|lysine, N6-benzoyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | lysine, N6-benzoyl- |
|---|
| CAS Number | 5107-18-6 | Molecular Weight | 250.29400 |
|---|
| Density | 1.186 g/cm3 | Boiling Point | 521ºC at 760mmHg |
|---|
| Molecular Formula | C13H18N2O3 | Melting Point | 268ºC |
|---|
| MSDS | / | Flash Point | 268.9ºC |
|---|
Names
| Name | 2-amino-6-benzamidohexanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.186 g/cm3 |
|---|
| Boiling Point | 521ºC at 760mmHg |
|---|
| Melting Point | 268ºC |
|---|
| Molecular Formula | C13H18N2O3 |
|---|
| Molecular Weight | 250.29400 |
|---|
| Flash Point | 268.9ºC |
|---|
| Exact Mass | 250.13200 |
|---|
| PSA | 92.42000 |
|---|
| LogP | 2.08980 |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | KODLJWKGAKBGOB-UHFFFAOYSA-N |
|---|
| SMILES | NC(CCCCNC(=O)c1ccccc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| F0266-0844 |
| N6-benzoyl-lysine |
| N-l-benzoyl lysine |
| N6-Benzoyl-lysin |
| 2-amino-6-(benzoylamino)hexanoic acid |
| N6-benzoyl-DL-lysine |
| 2-amino-6-(phenylcarbonylamino)hexanoic acid |
| Nepsilon-Benzoyllysine |
| N~6~-(phenylcarbonyl)lysine |
| N6-benzoyl-D-lysine |
