Introduction：Basic information about CAS 7536-55-2|BOC-L-Asparagine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BOC-L-Asparagine |
|---|
| CAS Number | 7536-55-2 | Molecular Weight | 232.234 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 481.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H16N2O5 | Melting Point | 170-175ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 245.1±27.3 °C |
|---|
Names
| Name | Nα-t-butoxycarbonyl-L-asparagine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 481.7±40.0 °C at 760 mmHg |
|---|
| Melting Point | 170-175ºC |
|---|
| Molecular Formula | C9H16N2O5 |
|---|
| Molecular Weight | 232.234 |
|---|
| Flash Point | 245.1±27.3 °C |
|---|
| Exact Mass | 232.105927 |
|---|
| PSA | 118.72000 |
|---|
| LogP | 0.27 |
|---|
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.497 |
|---|
| InChIKey | FYYSQDHBALBGHX-YFKPBYRVSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(N)=O)C(=O)O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Articles1
More Articles
| Transport and signaling via the amino acid binding site of the yeast Gap1 amino acid transceptor. Nat. Chem. Biol. 5 , 45-52, (2009) Transporter-related nutrient sensors, called transceptors, mediate nutrient activation of signaling pathways through the plasma membrane. The mechanism of action of transporting and nontransporting tr... | |
Synonyms
| N-(tert-butoxycarbonyl)-L-asparagine |
| MFCD00038152 |
| (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| N-BOC-L-asparagine |
| Na-(tert-Butoxycarbonyl)-L-asparagine |
| Boc-L-Asn-OH |
| tert-Butoxycarbonylasparagine |
| N-a-t-Boc-asparagine |
| Nalpha-Boc-L-asparagine |
| BOC-ASPARAGINE |
| N-(tert-butoxycarbonyl)asparagine |
| N-Boc-(S)-asparagine |
| N-Boc-Asparagine |
| Boc-Asn-OH |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}asparagine |
| L-Homoserine, N-[(1,1-dimethylethoxy)hydroxymethylene]-4-imino-, (E)- |
| L-Asparagine, N-[(1,1-dimethylethoxy)carbonyl]- |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-asparagine |
| Boc-Asn |
| (E)-N-{Hydroxy[(2-methyl-2-propanyl)oxy]methylene}-4-imino-L-homoserine |
| Asparagine, N-[(1,1-dimethylethoxy)carbonyl]- |
| EINECS 231-405-2 |
| Nalpha-(tert-Butoxycarbonyl)-L-asparagine |
| N2-(tert-Butoxycarbonyl)-L-asparagine |
| Boc-D-Asn-OH |
| N(alpha)-t-butoxycarbonyl-L-asparagine |
| BOC-L-Asparagine |
