Introduction：Basic information about CAS 32664-28-1|1H-Pyrazole,3-(4-methoxyphenyl)-5-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrazole,3-(4-methoxyphenyl)-5-phenyl- |
|---|
| CAS Number | 32664-28-1 | Molecular Weight | 250.29500 |
|---|
| Density | 1.161g/cm3 | Boiling Point | 472.6ºC at 760mmHg |
|---|
| Molecular Formula | C16H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.8ºC |
|---|
Names
| Name | 2-Hexenoic acid,3-(4-methoxyphenyl)-5-oxo |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.161g/cm3 |
|---|
| Boiling Point | 472.6ºC at 760mmHg |
|---|
| Molecular Formula | C16H14N2O |
|---|
| Molecular Weight | 250.29500 |
|---|
| Flash Point | 168.8ºC |
|---|
| Exact Mass | 250.11100 |
|---|
| PSA | 37.91000 |
|---|
| LogP | 3.75230 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | LEFIXAQPASZFND-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(-c3ccccc3)n[nH]2)cc1 |
|---|
Synonyms
| 3-phenyl-5-(4-methoxyphenyl)-1H-pyrazole |
| 5-Phenyl-3-(p-methoxy)-phenyl-pyrazol |
| 3-(4-methoxy-phenyl)-5-oxo-hex-2-enoic acid |
| 3-(4-Methoxy-phenyl)-5-oxo-hex-2-ensaeure |
| 3-(4-methoxyphenyl)-5-phenyl-1H-pyrazole |
| 3-(4-Methoxy-phenyl)-5-phenyl-1(2)H-pyrazol |
| 3-(4-methoxy-phenyl)-5-phenyl-1(2)H-pyrazole |
| 1H-3-(p-methoxyphenyl)-5-phenylpyrazole |
