Introduction:Basic information about CAS 68555-98-6|VULTAC 7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | VULTAC 7 |
|---|
| CAS Number | 68555-98-6 | Molecular Weight | 299.28000 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 472.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16Cl2OS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.1ºC |
|---|
Names
| Name | chlorosulfanyl thiohypochlorite,4-(2-methylbutan-2-yl)phenol |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 472.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H16Cl2OS2 |
|---|
| Molecular Weight | 299.28000 |
|---|
| Flash Point | 229.1ºC |
|---|
| Exact Mass | 298.00200 |
|---|
| PSA | 70.83000 |
|---|
| LogP | 5.75520 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | KMJSZOXXFCKGRN-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1ccc(O)cc1.ClSSCl |
|---|