Introduction：Basic information about CAS 17052-37-8|4-Quinolinol, 3-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Quinolinol, 3-phenyl- |
|---|
| CAS Number | 17052-37-8 | Molecular Weight | 221.25400 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C15H11NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.3ºC |
|---|
Names
| Name | 3-phenyl-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 385.3ºC at 760mmHg |
|---|
| Molecular Formula | C15H11NO |
|---|
| Molecular Weight | 221.25400 |
|---|
| Flash Point | 158.3ºC |
|---|
| Exact Mass | 221.08400 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.60740 |
|---|
| Vapour Pressure | 3.86E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | RLLYMKQAMJFPDL-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c(-c2ccccc2)c[nH]c2ccccc12 |
|---|
Synonyms
| 4-Hydroxy-3-phenyl-chinolin |
| 3-Phenyl-chinolin-4-carbonsaeure |
| 3-Phenyl-4-hydroxy-chinolin |
| 3-Phenyl-chinolin-4-ol |
| 3-phenyl-quinolin-4-ol |
| 3-phenyl-quinoline-4-carboxylic acid |
