Introduction：Basic information about CAS 6972-47-0|Phenol,2,4,6-trichloro-3,5-dimethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol,2,4,6-trichloro-3,5-dimethyl- |
|---|
| CAS Number | 6972-47-0 | Molecular Weight | 225.50000 |
|---|
| Density | 1.443 g/cm3 | Boiling Point | 280.3ºC at760mmHg |
|---|
| Molecular Formula | C8H7Cl3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.3ºC |
|---|
Names
| Name | 2,4,6-trichloro-3,5-dimethylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.443 g/cm3 |
|---|
| Boiling Point | 280.3ºC at760mmHg |
|---|
| Molecular Formula | C8H7Cl3O |
|---|
| Molecular Weight | 225.50000 |
|---|
| Flash Point | 123.3ºC |
|---|
| Exact Mass | 223.95600 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.96920 |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | ZNEWEUWJXXZLAD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)c(C)c(Cl)c(O)c1Cl |
|---|
Synonyms
| 2,4,6-Trichlor-3,5-dimethyl-phenol |
| 2,4,6-trichloro-3,5-dimethyl-phenol |
| 3,2,4,6-trichloro |
| 2.4.6-Trichlor-5-hydroxy-m-xylol |
| Phenol,2,4,6-trichloro-3,5-dimethyl |
