Introduction：Basic information about CAS 1077-74-3|Quinoline,4,7-dichloro-, 1-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Quinoline,4,7-dichloro-, 1-oxide |
|---|
| CAS Number | 1077-74-3 | Molecular Weight | 214.04800 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 370ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5Cl2NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.6ºC |
|---|
Names
| Name | 4,7-dichloro-1-oxidoquinolin-1-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 370ºC at 760 mmHg |
|---|
| Molecular Formula | C9H5Cl2NO |
|---|
| Molecular Weight | 214.04800 |
|---|
| Flash Point | 177.6ºC |
|---|
| Exact Mass | 212.97500 |
|---|
| PSA | 25.46000 |
|---|
| LogP | 3.57510 |
|---|
| Vapour Pressure | 2.43E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | VHGJNAHFEWJQKX-UHFFFAOYSA-N |
|---|
| SMILES | [O-][n+]1ccc(Cl)c2ccc(Cl)cc21 |
|---|
Synonyms
| 4,7-dichloroquinoline-N-oxide |
| 4,7-dichloroquinolin 1-oxide |
| 4,7-Dichlor-chinolin-N-oxid |
| 4.7-Dichlor-chinolin-1-oxid |
| 4,7-dichloroquinoline-1-oxide |
