Introduction：Basic information about CAS 29455-11-6|2,6-Dinitro-4-methyl anisole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dinitro-4-methyl anisole |
|---|
| CAS Number | 29455-11-6 | Molecular Weight | 212.16000 |
|---|
| Density | 1.383 g/cm3 | Boiling Point | 368.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H8N2O5 | Melting Point | 123-125ºC |
|---|
| MSDS | / | Flash Point | 182.9ºC |
|---|
Names
| Name | 2-methoxy-5-methyl-1,3-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.383 g/cm3 |
|---|
| Boiling Point | 368.9ºC at 760 mmHg |
|---|
| Melting Point | 123-125ºC |
|---|
| Molecular Formula | C8H8N2O5 |
|---|
| Molecular Weight | 212.16000 |
|---|
| Flash Point | 182.9ºC |
|---|
| Exact Mass | 212.04300 |
|---|
| PSA | 100.87000 |
|---|
| LogP | 2.86640 |
|---|
| Vapour Pressure | 2.62E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | HVNUPXQONRHUOX-UHFFFAOYSA-N |
|---|
| SMILES | COc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 2930.0 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Methoxy-3,5-dinitrotoluene |
| 2,6-dinitro-4-methylanisole |
| 4-METHOXY-3,5-DINITROTOLUENE |
| 1-Methoxy-4-methyl-2,6-dinitrobenzene |
| 2,5-DIMETHYL-1-[3-(METHYLTHIO)PHENYL]-1H-PYRROLE-3-CARBALDEHYDE |
| 4-Methyl-2,6-dinitro-anisol |
| 3.5-Dinitro-4-methoxy-toluol |
| 2,6-Dinitro-4-methylanisole |
| Methyl-(2.6-dinitro-4-methyl-phenyl)-aether |
| 4-methyl-2,6-dinitro-anisole |
| 4-Methyl-2,6-dinitroanisole |
