Introduction：Basic information about CAS 81447-78-1|Levlofexidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Levlofexidine |
|---|
| CAS Number | 81447-78-1 | Molecular Weight | 259.13200 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 421.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12Cl2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.7ºC |
|---|
Names
| Name | (R)-Lofexidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 421.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12Cl2N2O |
|---|
| Molecular Weight | 259.13200 |
|---|
| Flash Point | 208.7ºC |
|---|
| Exact Mass | 258.03300 |
|---|
| PSA | 33.62000 |
|---|
| LogP | 2.52680 |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | KSMAGQUYOIHWFS-SSDOTTSWSA-N |
|---|
| SMILES | CC(Oc1c(Cl)cccc1Cl)C1=NCCN1 |
|---|
Synonyms
| Britlofex |
| 2-[1-(2,6-dichlorophenoxy)ethyl]-2-imidazoline |
| (-)-2-[1-(2,6-dichlorophenoxy)-ethyl]-1,3-diazacyclopent-2-ene |
| Lofexidina |
| Lofexidine |
| rac-2-[1-(2,6-dichlorophenoxy)ethyl]-1,3-diazacyclopent-2-ene |
| Lofexidina [INN-Spanish] |
| Lofexidinum [INN-Latin] |
| rac-lofexidine |
| Lofexidine [INN:BAN] |
| Lofexidinum |
