Introduction:Basic information about CAS 6279-86-3|Triethyl methanetricarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triethyl methanetricarboxylate |
|---|
| CAS Number | 6279-86-3 | Molecular Weight | 232.230 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 281.3±7.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H16O6 | Melting Point | 25-26 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 118.3±18.2 °C |
|---|
Names
| Name | Triethyl methanetricarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 281.3±7.0 °C at 760 mmHg |
|---|
| Melting Point | 25-26 °C(lit.) |
|---|
| Molecular Formula | C10H16O6 |
|---|
| Molecular Weight | 232.230 |
|---|
| Flash Point | 118.3±18.2 °C |
|---|
| Exact Mass | 232.094681 |
|---|
| PSA | 78.90000 |
|---|
| LogP | 1.09 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.438 |
|---|
| InChIKey | AGZPNUZBDCYTBB-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)OCC |
|---|
| Water Solubility | immiscible |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|
| Hazard Codes | Xi |
|---|
| Safety Phrases | S23-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29171990 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 228-477-2 |
| 2-Ethoxycarbonyl-malonic acid diethyl ester |
| Methanetricarboxylic acid, triethyl ester |
| Diethyl 2-(ethoxycarbonyl)malonate |
| Tricarbethoxymethane |
| Carboxymalonic Acid Triethyl Ester |
| MFCD00009150 |
| Methanetricarboxylic acid,triethyl ester |
| methanetricarboxylic acid triethyl ester |
| Triethyl methanetricarboxylate |
| Triethylmethanetricarboxylate |
| tri(ethoxycarbonyl)methane |