Introduction：Basic information about CAS 742103-27-1|Di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine |
|---|
| CAS Number | 742103-27-1 | Molecular Weight | 352.49300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H33P | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | ditert-butyl-(1-methyl-2,2-diphenylcyclopropyl)phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H33P |
|---|
| Molecular Weight | 352.49300 |
|---|
| Exact Mass | 352.23200 |
|---|
| PSA | 13.59000 |
|---|
| LogP | 7.21400 |
|---|
| InChIKey | QMLPJDVGNRHGJQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)P(C(C)(C)C)C1(C)CC1(c1ccccc1)c1ccccc1 |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Mo-Phos |
| di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine |
| Di-t-butyl(2,2-diphenyl-1-methylcyclopropyl)phosphinecBRIDP |
| di-t-butyl(2,2-diphenyl-1-methyl-1-cyclopropyl)phosphine |
| cBRIDP |
| Phosphine,bis(1,1-dimethylethyl)(1-methyl-2,2-diphenylcyclopropyl) |
| (2,2-DIPHENYL-1-(DI-TERT-BUTYLPHOSPHINO)-1-METHYLCYCLOPROPANE) |
| di-tert-butyl(2,2-diphenyl-1-methyl-1-cyclopropyl)phosphine |
| di-t-butyl-(2,2-diphenyl-1-methylcyclopropyl)phosphine |
