Introduction:Basic information about CAS 227803-35-2|5-chloro-3-phenylsulfanyl-1H-indole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-chloro-3-phenylsulfanyl-1H-indole |
|---|
| CAS Number | 227803-35-2 | Molecular Weight | 259.75400 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 452.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H10ClNS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.7ºC |
|---|
Names
| Name | 5-chloro-3-phenylsulfanyl-1H-indole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 452.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H10ClNS |
|---|
| Molecular Weight | 259.75400 |
|---|
| Flash Point | 227.7ºC |
|---|
| Exact Mass | 259.02200 |
|---|
| PSA | 41.09000 |
|---|
| LogP | 4.97250 |
|---|
| Vapour Pressure | 5.83E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.734 |
|---|
| InChIKey | CCHHXGFVRASIEZ-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc2[nH]cc(Sc3ccccc3)c2c1 |
|---|
Synonyms
| 5-chloro-3-(phenylsulfanyl)indole |
| 5-Chloro-3-(phenylthio)-indole |
| 1H-Indole,5-chloro-3-(phenylthio) |
| 5-chloro-3-(phenylthio)-1h-indole |